Difference between revisions of "VAL"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN] == * direction: ** LEF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] == * smiles: ** CC(C)C([N+])C([O-])=O * inchi key: ** InChIKey=KZSNJWFQEVHDMF-BYPYZUCN...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C([N+])C([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-valine |
− | * | + | * molecular weight: |
− | ** | + | ** 117.147 |
* Synonym(s): | * Synonym(s): | ||
+ | ** V | ||
+ | ** val | ||
+ | ** valine | ||
+ | ** L-val | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[VALINE--TRNA-LIGASE-RXN]] |
− | + | * [[biomass_rxn]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]] | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 72-18-4 |
− | ** [http:// | + | * BIGG : 34167 |
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971018 6971018] |
− | * | + | * HMDB : HMDB00883 |
− | ** [http://www. | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00183 C00183] | |
− | * | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57762 57762] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57762 |
− | {{#set: | + | {{#set: smiles=CC(C)C([N+])C([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N}} |
− | {{#set: | + | {{#set: common name=L-valine}} |
− | {{#set: | + | {{#set: molecular weight=117.147 }} |
− | {{#set: | + | {{#set: common name=V|val|valine|L-val}} |
− | + | {{#set: consumed by=VALINE--TRNA-LIGASE-RXN|biomass_rxn}} | |
+ | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERVAL-RXN}} |
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite VAL
- smiles:
- CC(C)C([N+])C([O-])=O
- inchi key:
- InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N
- common name:
- L-valine
- molecular weight:
- 117.147
- Synonym(s):
- V
- val
- valine
- L-val
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 72-18-4
- BIGG : 34167
- PUBCHEM:
- HMDB : HMDB00883
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57762
"CC(C)C([N+])C([O-])=O" cannot be used as a page name in this wiki.