Difference between revisions of "CPD0-1905"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14201 RXN-14201] == * direction: ** LEFT-TO-RIGHT * common name: ** Apyrase * ec number: ** [ht...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14201 RXN-14201] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
 +
* inchi key:
 +
** InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
 
* common name:
 
* common name:
−
** Apyrase
+
** 8-oxo-dGTP
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
+
** 519.151   
 
* Synonym(s):
 
* Synonym(s):
 +
** 8-oxo-7,8-dihydro-2'-dGTP
 +
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[GTP]][c] '''+''' 2 [[WATER]][c] '''=>''' 2 [[PROTON]][c] '''+''' 2 [[Pi]][c] '''+''' 1 [[GMP]][c]
+
* [[RXN-11410]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 GTP[c] '''+''' 2 H2O[c] '''=>''' 2 H+[c] '''+''' 2 phosphate[c] '''+''' 1 GMP[c]
+
* [[RXN-14205]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-02_001970]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Apyrase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237341 44237341]
−
{{#set: ec number=EC-3.6.1.5}}
+
* CHEBI:
−
{{#set: gene associated=Ec-02_001970}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77896 77896]
−
{{#set: in pathway=}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=8-oxo-dGTP}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: molecular weight=519.151    }}
 +
{{#set: common name=8-oxo-7,8-dihydro-2'-dGTP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate}}
 +
{{#set: produced by=RXN-11410}}
 +
{{#set: reversible reaction associated=RXN-14205}}

Latest revision as of 19:40, 21 March 2018

Metabolite CPD0-1905

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
  • common name:
    • 8-oxo-dGTP
  • molecular weight:
    • 519.151
  • Synonym(s):
    • 8-oxo-7,8-dihydro-2'-dGTP
    • 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-1905&oldid=28594"