Difference between revisions of "EDTA"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_001510 == * left end position: ** 1502212 * transcription direction: ** NEGATIVE * right end position: ** 1503331 * centisome position: ** 30.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * inchi key...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L |
| − | * | + | * common name: |
| − | ** | + | ** EDTA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 290.229 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ethylenediaminetetraacetic acid |
| − | ** | + | ** ethylenediaminetetraacetate |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[TransportSeed_EDTA]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[TransportSeed_EDTA]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | * [[ExchangeSeed_EDTA]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201827 25201827] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42191 42191] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284] |
| − | {{#set: | + | * HMDB : HMDB15109 |
| + | {{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=EDTA}} | ||
| + | {{#set: molecular weight=290.229 }} | ||
| + | {{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}} | ||
| + | {{#set: consumed by=TransportSeed_EDTA}} | ||
| + | {{#set: produced by=TransportSeed_EDTA}} | ||
| + | {{#set: reversible reaction associated=ExchangeSeed_EDTA}} | ||
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite EDTA
- smiles:
- C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
- inchi key:
- InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
- common name:
- EDTA
- molecular weight:
- 290.229
- Synonym(s):
- ethylenediaminetetraacetic acid
- ethylenediaminetetraacetate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.
