Difference between revisions of "RXN-15137"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15137 RXN-15137] == * direction: ** REVERSIBLE * common name: ** Cys/Met metabolism, pyridoxal...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15137 RXN-15137] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
+
 
* common name:
 
* common name:
−
** 8-oxo-dGTP
+
** Cys/Met metabolism, pyridoxal phosphate-dependent enzyme
−
* molecular weight:
+
** Cystathionine beta-lyase
−
** 519.151   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-7,8-dihydro-2'-dGTP
 
−
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11410]]
+
** 1 [[CPD-13717]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[SELENOHOMOCYSTEINE]][c] '''+''' 1 [[2-AMINOACRYLATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-14205]]
+
** 1 L-selenocystathionine[c] '''<=>''' 1 H+[c] '''+''' 1 seleno-L-homocysteine[c] '''+''' 1 2-aminoprop-2-enoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-00_002820]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-05_006760]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237341 44237341]
+
{{#set: common name=Cys/Met metabolism, pyridoxal phosphate-dependent enzyme}}
−
* CHEBI:
+
{{#set: common name=Cystathionine beta-lyase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77896 77896]
+
{{#set: gene associated=Ec-00_002820|Ec-05_006760}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=8-oxo-dGTP}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=519.151    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=8-oxo-7,8-dihydro-2'-dGTP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate}}
+
−
{{#set: produced by=RXN-11410}}
+
−
{{#set: consumed or produced by=RXN-14205}}
+

Latest revision as of 19:40, 21 March 2018

Reaction RXN-15137

  • direction:
    • REVERSIBLE
  • common name:
    • Cys/Met metabolism, pyridoxal phosphate-dependent enzyme
    • Cystathionine beta-lyase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15137&oldid=28610"