Difference between revisions of "RXN-10994"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * inchi key...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10994 RXN-10994] == * direction: ** REVERSIBLE * common name: ** holo-[acyl-carrier-protein] sy...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10994 RXN-10994] ==
−
* smiles:
+
* direction:
−
** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** EDTA
+
** holo-[acyl-carrier-protein] synthase
−
* molecular weight:
+
* ec number:
−
** 290.229   
+
** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7]
 
* Synonym(s):
 
* Synonym(s):
−
** ethylenediaminetetraacetic acid
 
−
** ethylenediaminetetraacetate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[TransportSeed_EDTA]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[VibB]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[holo-VibB]][c] '''+''' 1 [[PROTON]][c]
−
* [[TransportSeed_EDTA]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 an apo-[VibB aryl-carrier protein][c] '''+''' 1 coenzyme A[c] '''<=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a holo-[VibB aryl-carrier protein][c] '''+''' 1 H+[c]
−
* [[ExchangeSeed_EDTA]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_004620]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-01_000130]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201827 25201827]
+
{{#set: common name=holo-[acyl-carrier-protein] synthase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.7.8.7}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42191 42191]
+
{{#set: gene associated=Ec-06_004620|Ec-01_000130}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB15109
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}}
+
−
{{#set: common name=EDTA}}
+
−
{{#set: molecular weight=290.229    }}
+
−
{{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}}
+
−
{{#set: consumed by=TransportSeed_EDTA}}
+
−
{{#set: produced by=TransportSeed_EDTA}}
+
−
{{#set: consumed or produced by=ExchangeSeed_EDTA}}
+

Latest revision as of 19:40, 21 March 2018

Reaction RXN-10994

  • direction:
    • REVERSIBLE
  • common name:
    • holo-[acyl-carrier-protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an apo-[VibB aryl-carrier protein][c] + 1 coenzyme A[c] <=> 1 adenosine 3',5'-bisphosphate[c] + 1 a holo-[VibB aryl-carrier protein][c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"holo-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10994&oldid=28615"