Difference between revisions of "Ec-09 004260"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-334 CPD-334] == * smiles: ** C(C(C(C(C(C([O-])=O)=O)=O)O)O)O * inchi key: ** InChIKey=GJQWC...") |
(Created page with "Category:Gene == Gene Ec-09_004260 == * left end position: ** 4802691 * transcription direction: ** POSITIVE * right end position: ** 4808782 * centisome position: ** 85.5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_004260 == |
− | * | + | * left end position: |
− | ** | + | ** 4802691 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4808782 |
− | * | + | * centisome position: |
− | ** | + | ** 85.56126 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0049_0112 |
− | ** | + | ** Esi0049_0112 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[4.2.2.10-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[RXN-14897]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7243]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4802691}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4808782}} | |
− | + | {{#set: centisome position=85.56126 }} | |
− | + | {{#set: common name=Esi_0049_0112|Esi0049_0112}} | |
− | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} | |
− | + | {{#set: pathway associated=PWY-7243}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:41, 21 March 2018
Gene Ec-09_004260
- left end position:
- 4802691
- transcription direction:
- POSITIVE
- right end position:
- 4808782
- centisome position:
- 85.56126
- Synonym(s):
- Esi_0049_0112
- Esi0049_0112
Reactions associated
- Reaction: 4.2.2.10-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14897
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome