Difference between revisions of "CPD-12653"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-24_000980 == * left end position: ** 992682 * transcription direction: ** POSITIVE * right end position: ** 999413 * centisome position: ** 19.902...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-] * common name: ** stearidon...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-24_000980 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] ==
* left end position:
+
* smiles:
** 992682
+
** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** stearidonate
* right end position:
+
* inchi key:
** 999413
+
** InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-M
* centisome position:
+
* molecular weight:
** 19.902712    
+
** 275.41    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0019_0088
+
** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate
** Esi0019_0088
+
** ((6Z,9Z,12Z,15Z)-octadecatetraenoate
 +
** all-cis-octadeca-6,9,12,15-tetraenoic acid
 +
** (6Z,9Z,12Z,15Z)-octadecatetraenoic acid
 +
** octadecatetraenoate
 +
** stearidonic acid
 +
** octadecatetraenoic acid
 +
** cis-6,9,12,15-octadecatetraenoate
 +
** 6,9,12,15-(Z,Z,Z,Z)-octadecatetraenoic acid
 +
** cis-6,9,12,15-octadecatetraenoic acid
 +
** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid
 +
** moroctic acid
 +
** moroctate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.8.1.6-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
***go-term
+
* [[RXN-8349_PLANTCYC]]
* [[RXN-17472]]
+
* [[R07861]]
** esiliculosus_genome
+
***go-term
+
* [[RXN-17473]]
+
** esiliculosus_genome
+
***go-term
+
== Pathways associated ==
+
* [[PWY0-1507]]
+
* [[PWY-7380]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=992682}}
+
* Wikipedia : Stearidonic_acid
{{#set: transcription direction=POSITIVE}}
+
* HMDB : HMDB06547
{{#set: right end position=999413}}
+
* CHEBI:
{{#set: centisome position=19.902712   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77222 77222]
{{#set: common name=Esi_0019_0088|Esi0019_0088}}
+
* PUBCHEM:
{{#set: reaction associated=2.8.1.6-RXN|RXN-17472|RXN-17473}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245840 25245840]
{{#set: pathway associated=PWY0-1507|PWY-7380}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16300 C16300]
 +
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)[O-]}}
 +
{{#set: common name=stearidonate}}
 +
{{#set: inchi key=InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-M}}
 +
{{#set: molecular weight=275.41   }}
 +
{{#set: common name=(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate|((6Z,9Z,12Z,15Z)-octadecatetraenoate|all-cis-octadeca-6,9,12,15-tetraenoic acid|(6Z,9Z,12Z,15Z)-octadecatetraenoic acid|octadecatetraenoate|stearidonic acid|octadecatetraenoic acid|cis-6,9,12,15-octadecatetraenoate|6,9,12,15-(Z,Z,Z,Z)-octadecatetraenoic acid|cis-6,9,12,15-octadecatetraenoic acid|(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid|moroctic acid|moroctate}}
 +
{{#set: reversible reaction associated=RXN-8349_PLANTCYC|R07861}}

Latest revision as of 19:41, 21 March 2018

Metabolite CPD-12653

  • smiles:
    • CCC=CCC=CCC=CCC=CCCCCC(=O)[O-]
  • common name:
    • stearidonate
  • inchi key:
    • InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-M
  • molecular weight:
    • 275.41
  • Synonym(s):
    • (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate
    • ((6Z,9Z,12Z,15Z)-octadecatetraenoate
    • all-cis-octadeca-6,9,12,15-tetraenoic acid
    • (6Z,9Z,12Z,15Z)-octadecatetraenoic acid
    • octadecatetraenoate
    • stearidonic acid
    • octadecatetraenoic acid
    • cis-6,9,12,15-octadecatetraenoate
    • 6,9,12,15-(Z,Z,Z,Z)-octadecatetraenoic acid
    • cis-6,9,12,15-octadecatetraenoic acid
    • (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid
    • moroctic acid
    • moroctate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • Wikipedia : Stearidonic_acid
  • HMDB : HMDB06547
  • CHEBI:
  • PUBCHEM:
  • LIGAND-CPD:
"CCC=CCC=CCC=CCC=CCCCCC(=O)[O-" cannot be used as a page name in this wiki.