Difference between revisions of "Non-Galactosylated-Galactose-Acceptors"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Galactosylated-Galactose-Acceptors Non-Galactosylated-Galactose-Acceptors] == * common name...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Galactosylated-Galactose-Acceptors Non-Galactosylated-Galactose-Acceptors] ==
* smiles:
+
** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C
+
* inchi key:
+
** InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N
+
 
* common name:
 
* common name:
** γ-carotene
+
** a non galactosylated galactose acceptor
* molecular weight:
+
** 536.882   
+
 
* Synonym(s):
 
* Synonym(s):
** β,ψ-carotene
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-151]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-150]]
+
* [[3.2.1.23-RXN]]
 +
* [[RXN-12088]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR01070260
+
{{#set: common name=a non galactosylated galactose acceptor}}
* PUBCHEM:
+
{{#set: produced by=3.2.1.23-RXN|RXN-12088}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280791 5280791]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4444349.html 4444349]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27740 27740]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05435 C05435]
+
{{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N}}
+
{{#set: common name=γ-carotene}}
+
{{#set: molecular weight=536.882    }}
+
{{#set: common name=β,ψ-carotene}}
+
{{#set: consumed by=RXN1F-151}}
+
{{#set: produced by=RXN1F-150}}
+

Latest revision as of 19:41, 21 March 2018

Metabolite Non-Galactosylated-Galactose-Acceptors

  • common name:
    • a non galactosylated galactose acceptor
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links