Difference between revisions of "Ec-10 000680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...")
 
(Created page with "Category:Gene == Gene Ec-10_000680 == * left end position: ** 748309 * transcription direction: ** POSITIVE * right end position: ** 766776 * centisome position: ** 11.510...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] ==
+
== Gene Ec-10_000680 ==
−
* smiles:
+
* left end position:
−
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
+
** 748309
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** ent-kaur-16-en-19-oate
+
** 766776
−
* molecular weight:
+
* centisome position:
−
** 301.448    
+
** 11.510701    
 
* Synonym(s):
 
* Synonym(s):
−
** ent-kaurenoate
+
** Esi_0138_0042
−
** ent-kaurenoic acid
+
** Esi0138_0042
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.14.13.79-RXN]]
+
* Reaction: [[3.4.21.102-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104130004
+
{{#set: left end position=748309}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785]
+
{{#set: right end position=766776}}
−
* CHEBI:
+
{{#set: centisome position=11.510701   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297]
+
{{#set: common name=Esi_0138_0042|Esi0138_0042}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.4.21.102-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874]
+
−
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}}
+
−
{{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}}
+
−
{{#set: common name=ent-kaur-16-en-19-oate}}
+
−
{{#set: molecular weight=301.448   }}
+
−
{{#set: common name=ent-kaurenoate|ent-kaurenoic acid}}
+
−
{{#set: consumed by=1.14.13.79-RXN}}
+

Latest revision as of 19:41, 21 March 2018

Gene Ec-10_000680

  • left end position:
    • 748309
  • transcription direction:
    • POSITIVE
  • right end position:
    • 766776
  • centisome position:
    • 11.510701
  • Synonym(s):
    • Esi_0138_0042
    • Esi0138_0042

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_000680&oldid=28690"