Difference between revisions of "PYRAZINOIC-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-21_005790 == * left end position: ** 6704078 * transcription direction: ** POSITIVE * right end position: ** 6712979 * centisome position: ** 90.8...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] == * smiles: ** C1(N=CC=NC=1C([O-])=O) * inchi key: ** InChIKe...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-21_005790 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] ==
* left end position:
+
* smiles:
** 6704078
+
** C1(N=CC=NC=1C([O-])=O)
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M
* right end position:
+
* common name:
** 6712979
+
** pyrazine-2-carboxylate
* centisome position:
+
* molecular weight:
** 90.8397    
+
** 123.091    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0014_0093
+
** pyrazinoate
** Esi0014_0093
+
** pyrazinoic acid
** PK
+
** pyrazinecarboxylic acid
 +
** pyrazinemonocarboxylic acid
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[PYRAZIN-RXN]]
***go-term
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=6704078}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3728869 3728869]
{{#set: right end position=6712979}}
+
* CHEMSPIDER:
{{#set: centisome position=90.8397   }}
+
** [http://www.chemspider.com/Chemical-Structure.2959374.html 2959374]
{{#set: common name=Esi_0014_0093|Esi0014_0093|PK}}
+
* CHEBI:
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71266 71266]
 +
* NCI:
 +
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=27192 27192]
 +
{{#set: smiles=C1(N=CC=NC=1C([O-])=O)}}
 +
{{#set: inchi key=InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M}}
 +
{{#set: common name=pyrazine-2-carboxylate}}
 +
{{#set: molecular weight=123.091   }}
 +
{{#set: common name=pyrazinoate|pyrazinoic acid|pyrazinecarboxylic acid|pyrazinemonocarboxylic acid}}
 +
{{#set: produced by=PYRAZIN-RXN}}

Latest revision as of 19:41, 21 March 2018

Metabolite PYRAZINOIC-ACID

  • smiles:
    • C1(N=CC=NC=1C([O-])=O)
  • inchi key:
    • InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M
  • common name:
    • pyrazine-2-carboxylate
  • molecular weight:
    • 123.091
  • Synonym(s):
    • pyrazinoate
    • pyrazinoic acid
    • pyrazinecarboxylic acid
    • pyrazinemonocarboxylic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(N=CC=NC=1C([O-])=O)" cannot be used as a page name in this wiki.