Difference between revisions of "Short-RNA-Fragments"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * smiles: ** C(O)C1(OCC(O)C(O)C(O)1) * inchi key: ** InChIKey=MPCAJMNYNOG...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-RNA-Fragments Short-RNA-Fragments] == * common name: ** a short RNA Segment * Synonym(s):...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-RNA-Fragments Short-RNA-Fragments] ==
* smiles:
+
** C(O)C1(OCC(O)C(O)C(O)1)
+
* inchi key:
+
** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
+
 
* common name:
 
* common name:
** 1,5-anhydro-D-mannitol
+
** a short RNA Segment
* molecular weight:
+
** 164.158   
+
 
* Synonym(s):
 
* Synonym(s):
** 1,5-anhydromannitol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13064]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN0-5021]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a short RNA Segment}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445184 445184]
+
{{#set: reversible reaction associated=RXN0-5021}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.392897.html 392897]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538]
+
{{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}}
+
{{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}}
+
{{#set: common name=1,5-anhydro-D-mannitol}}
+
{{#set: molecular weight=164.158    }}
+
{{#set: common name=1,5-anhydromannitol}}
+
{{#set: consumed by=RXN-13064}}
+

Latest revision as of 19:41, 21 March 2018

Metabolite Short-RNA-Fragments

  • common name:
    • a short RNA Segment
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links