Difference between revisions of "HISTONE-ACETYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROQUINATE DEHYDROQUINATE] == * smiles: ** C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HISTONE-ACETYLTRANSFERASE-RXN HISTONE-ACETYLTRANSFERASE-RXN] == * direction: ** REVERSIBLE * common...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HISTONE-ACETYLTRANSFERASE-RXN HISTONE-ACETYLTRANSFERASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** histone acetyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.48 EC-2.3.1.48] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ACETYL-COA]][c] '''+''' 1 [[Histone-L-lysine]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[Histone-Acetyl-Lysine]][c] '''+''' 1 [[CO-A]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 acetyl-CoA[c] '''+''' 1 a [histone]-L-lysine[c] '''<=>''' 1 H+[c] '''+''' 1 a [histone]-N6-acetyl-L-lysine[c] '''+''' 1 coenzyme A[c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-08_005530]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-16_003590]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-18_002500]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-11_001290]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-11_006100]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-18_002510]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-01_007540]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-05_003120]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-03_000930]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03552 R03552] | |
− | + | * UNIPROT: | |
− | + | ** [http://www.uniprot.org/uniprot/Q12341 Q12341] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/Q02908 Q02908] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=REVERSIBLE}} |
− | * | + | {{#set: common name=histone acetyltransferase}} |
− | ** [http://www. | + | {{#set: ec number=EC-2.3.1.48}} |
− | + | {{#set: gene associated=Ec-08_005530|Ec-16_003590|Ec-18_002500|Ec-11_001290|Ec-11_006100|Ec-18_002510|Ec-01_007540|Ec-05_003120|Ec-03_000930}} | |
− | ** [http://www. | + | {{#set: in pathway=}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:41, 21 March 2018
Contents
Reaction HISTONE-ACETYLTRANSFERASE-RXN
- direction:
- REVERSIBLE
- common name:
- histone acetyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACETYL-COA[c] + 1 Histone-L-lysine[c] <=> 1 PROTON[c] + 1 Histone-Acetyl-Lysine[c] + 1 CO-A[c]
- With common name(s):
- 1 acetyl-CoA[c] + 1 a [histone]-L-lysine[c] <=> 1 H+[c] + 1 a [histone]-N6-acetyl-L-lysine[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-08_005530
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-16_003590
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-18_002500
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-11_001290
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-11_006100
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-18_002510
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_007540
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-05_003120
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-03_000930
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links