Difference between revisions of "3-UREIDO-ISOBUTYRATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(C(O)C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key: ** InC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-UREIDO-ISOBUTYRATE 3-UREIDO-ISOBUTYRATE] == * smiles: ** CC(CNC(N)=O)C(=O)[O-] * inchi key: *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-UREIDO-ISOBUTYRATE 3-UREIDO-ISOBUTYRATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(CNC(N)=O)C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PHENTZNALBMCQD-GSVOUGTGSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (R)-3-ureido-isobutanoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 145.138 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N-carbamyl-β-aminoisobutyric acid |
| + | ** N-carbamyl-β-aminoisobutyrate | ||
| + | ** (R)-3-ureido-isobutyrate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11210]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820371 91820371] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.19988990.html 19988990] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74414 74414] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05100 C05100] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB02031 |
| − | {{#set: common name= | + | {{#set: smiles=CC(CNC(N)=O)C(=O)[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=PHENTZNALBMCQD-GSVOUGTGSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=(R)-3-ureido-isobutanoate}} |
| − | + | {{#set: molecular weight=145.138 }} | |
| − | {{#set: consumed | + | {{#set: common name=N-carbamyl-β-aminoisobutyric acid|N-carbamyl-β-aminoisobutyrate|(R)-3-ureido-isobutyrate}} |
| + | {{#set: consumed by=RXN-11210}} | ||
Latest revision as of 20:42, 21 March 2018
Contents
Metabolite 3-UREIDO-ISOBUTYRATE
- smiles:
- CC(CNC(N)=O)C(=O)[O-]
- inchi key:
- InChIKey=PHENTZNALBMCQD-GSVOUGTGSA-M
- common name:
- (R)-3-ureido-isobutanoate
- molecular weight:
- 145.138
- Synonym(s):
- N-carbamyl-β-aminoisobutyric acid
- N-carbamyl-β-aminoisobutyrate
- (R)-3-ureido-isobutyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CNC(N)=O)C(=O)[O-" cannot be used as a page name in this wiki.
