Difference between revisions of "Ec-09 002160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * in...")
 
(Created page with "Category:Gene == Gene Ec-09_002160 == * left end position: ** 2531774 * transcription direction: ** NEGATIVE * right end position: ** 2549731 * centisome position: ** 45.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] ==
+
== Gene Ec-09_002160 ==
−
* smiles:
+
* left end position:
−
** C(OP([O-])(=O)[O-])C(O)CO
+
** 2531774
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AWUCVROLDVIAJX-VKHMYHEASA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** sn-glycerol 1-phosphate
+
** 2549731
−
* molecular weight:
+
* centisome position:
−
** 170.058    
+
** 45.104248    
 
* Synonym(s):
 
* Synonym(s):
−
** D-glycerol 3-phosphate
+
** Esi_0074_0087
−
** L-glycerol 1-phosphate
+
** Esi0074_0087
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[2.5.1.41-RXN]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2531774}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048685 7048685]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=2549731}}
−
** [http://www.chemspider.com/Chemical-Structure.5408879.html 5408879]
+
{{#set: centisome position=45.104248   }}
−
* CHEBI:
+
{{#set: common name=Esi_0074_0087|Esi0074_0087}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57685 57685]
+
{{#set: reaction associated=ATPASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00623 C00623]
+
−
{{#set: smiles=C(OP([O-])(=O)[O-])C(O)CO}}
+
−
{{#set: inchi key=InChIKey=AWUCVROLDVIAJX-VKHMYHEASA-L}}
+
−
{{#set: common name=sn-glycerol 1-phosphate}}
+
−
{{#set: molecular weight=170.058   }}
+
−
{{#set: common name=D-glycerol 3-phosphate|L-glycerol 1-phosphate}}
+
−
{{#set: consumed by=2.5.1.41-RXN}}
+

Latest revision as of 19:42, 21 March 2018

Gene Ec-09_002160

  • left end position:
    • 2531774
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2549731
  • centisome position:
    • 45.104248
  • Synonym(s):
    • Esi_0074_0087
    • Esi0074_0087

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_002160&oldid=28775"