Difference between revisions of "Ec-24 002750"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C-DI-GMP C-DI-GMP] == * smiles: ** C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)...")
 
(Created page with "Category:Gene == Gene Ec-24_002750 == * left end position: ** 3019429 * transcription direction: ** NEGATIVE * right end position: ** 3029972 * centisome position: ** 60.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C-DI-GMP C-DI-GMP] ==
+
== Gene Ec-24_002750 ==
−
* smiles:
+
* left end position:
−
** C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))
+
** 3019429
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** cyclic di-3',5'-guanylate
+
** 3029972
−
* molecular weight:
+
* centisome position:
−
** 688.4    
+
** 60.537846    
 
* Synonym(s):
 
* Synonym(s):
−
** cyclic di-3',5'-GMP
+
** Esi_0340_0006
−
** c-di-GMP
+
** Esi0340_0006
−
** c-di-guanylate
+
** MEP26
−
** cyclic bis(3' -> 5') dimeric GMP
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-9839]]
−
* [[RXN0-5359]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6082]]
 +
* [[PWY-6073]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3019429}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245336 25245336]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3029972}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58805 58805]
+
{{#set: centisome position=60.537846   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0340_0006|Esi0340_0006|MEP26}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16463 C16463]
+
{{#set: reaction associated=RXN-9839}}
−
{{#set: smiles=C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))}}
+
{{#set: pathway associated=PWY-6082|PWY-6073}}
−
{{#set: inchi key=InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L}}
+
−
{{#set: common name=cyclic di-3',5'-guanylate}}
+
−
{{#set: molecular weight=688.4   }}
+
−
{{#set: common name=cyclic di-3',5'-GMP|c-di-GMP|c-di-guanylate|cyclic bis(3' -> 5') dimeric GMP}}
+
−
{{#set: produced by=RXN0-5359}}
+

Latest revision as of 19:42, 21 March 2018

Gene Ec-24_002750

  • left end position:
    • 3019429
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3029972
  • centisome position:
    • 60.537846
  • Synonym(s):
    • Esi_0340_0006
    • Esi0340_0006
    • MEP26

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_002750&oldid=28786"