Difference between revisions of "Ec-11 003120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=...")
 
(Created page with "Category:Gene == Gene Ec-11_003120 == * left end position: ** 3255381 * transcription direction: ** POSITIVE * right end position: ** 3262953 * centisome position: ** 51.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] ==
+
== Gene Ec-11_003120 ==
−
* smiles:
+
* left end position:
−
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
+
** 3255381
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
+
** 3262953
−
* molecular weight:
+
* centisome position:
−
** 492.298    
+
** 51.757683    
 
* Synonym(s):
 
* Synonym(s):
−
** iPDP
+
** Esi_0048_0106
−
** isopentenyladenosine riboside-5'-diphosphate
+
** Esi0048_0106
−
** iPRDP
+
−
** isopentenyladenosine-5'-diphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-4305]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3255381}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202829 25202829]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3262953}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73533 73533]
+
{{#set: centisome position=51.757683   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0048_0106|Esi0048_0106}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16426 C16426]
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C}}
+
−
{{#set: inchi key=InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K}}
+
−
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate}}
+
−
{{#set: molecular weight=492.298   }}
+
−
{{#set: common name=iPDP|isopentenyladenosine riboside-5'-diphosphate|iPRDP|isopentenyladenosine-5'-diphosphate}}
+
−
{{#set: produced by=RXN-4305}}
+

Latest revision as of 19:42, 21 March 2018

Gene Ec-11_003120

  • left end position:
    • 3255381
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3262953
  • centisome position:
    • 51.757683
  • Synonym(s):
    • Esi_0048_0106
    • Esi0048_0106

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-11_003120&oldid=28789"