Difference between revisions of "Ec-19 003590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...")
 
(Created page with "Category:Gene == Gene Ec-19_003590 == * left end position: ** 3861214 * transcription direction: ** POSITIVE * right end position: ** 3869424 * centisome position: ** 64.6...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] ==
+
== Gene Ec-19_003590 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C(=O)CC(O)CCl
+
** 3861214
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5-chloro-4-hydroxy-2-oxopentanoate
+
** 3869424
−
* molecular weight:
+
* centisome position:
−
** 165.553    
+
** 64.669495    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-chloro-4-hydroxy-2-oxovalerate
+
** Esi_0245_0003
 +
** Esi0245_0003
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
* [[RXN-11717]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3861214}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}}
+
{{#set: right end position=3869424}}
−
{{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}}
+
{{#set: centisome position=64.669495   }}
−
{{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}}
+
{{#set: common name=Esi_0245_0003|Esi0245_0003}}
−
{{#set: molecular weight=165.553   }}
+
{{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}}
−
{{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}}
+
−
{{#set: produced by=RXN-11717}}
+

Latest revision as of 19:42, 21 March 2018

Gene Ec-19_003590

  • left end position:
    • 3861214
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3869424
  • centisome position:
    • 64.669495
  • Synonym(s):
    • Esi_0245_0003
    • Esi0245_0003

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_003590&oldid=28819"