Difference between revisions of "RXN-17688"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C(=O)[O-])C(C([O-])=O)O * inchi key: ** InChIKey=JUCRENB...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17688 RXN-17688] == * direction: ** REVERSIBLE * common name: ** Lyso-phosphatidylcholine acylt...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17688 RXN-17688] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Lyso-phosphatidylcholine acyltransferase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[CPD-17282]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[Glycerolipids]][c] '''+''' 1 [[CPD-14018]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 a [glycerolipid]-icosapentaenoate[c] '''+''' 1 coenzyme A[c] '''<=>''' 1 a glycerolipid[c] '''+''' 1 icosapentaenoyl-CoA[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-16_002160]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-7053]], docosahexaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7053 PWY-7053] | ||
| + | ** '''5''' reactions found over '''7''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Lyso-phosphatidylcholine acyltransferase}} | |
| − | + | {{#set: ec number=EC-2.3.1.23}} | |
| − | + | {{#set: gene associated=Ec-16_002160}} | |
| − | + | {{#set: in pathway=PWY-7053}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:42, 21 March 2018
Contents
Reaction RXN-17688
- direction:
- REVERSIBLE
- common name:
- Lyso-phosphatidylcholine acyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-17282[c] + 1 CO-A[c] <=> 1 Glycerolipids[c] + 1 CPD-14018[c]
- With common name(s):
- 1 a [glycerolipid]-icosapentaenoate[c] + 1 coenzyme A[c] <=> 1 a glycerolipid[c] + 1 icosapentaenoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-16_002160
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7053, docosahexaenoate biosynthesis I (lower eukaryotes): PWY-7053
- 5 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
