Difference between revisions of "Ox-Thioredoxin"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ox-Thioredoxin Ox-Thioredoxin] == * common name: ** an oxidized thioredoxin * Synonym(s): ** th...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ox-Thioredoxin Ox-Thioredoxin] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
** 3,8-divinyl chlorophyllide a
+
** an oxidized thioredoxin
* molecular weight:
+
** 610.951   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** thioredoxin disulfide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5285]]
+
* [[RXN0-5468]]
 +
* [[CDPREDUCT-RXN]]
 +
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
 +
* [[UDPREDUCT-RXN]]
 +
* [[RXN-8668]]
 +
* [[1.8.4.14-RXN]]
 +
* [[THIOREDOXIN-RXN]]
 +
* [[GDPREDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ADPREDUCT-RXN]]
 +
* [[1.8.4.12-RXN]]
 +
* [[1.17.4.2-RXN]]
 +
* [[1.8.4.8-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an oxidized thioredoxin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927710 56927710]
+
{{#set: common name=thioredoxin disulfide}}
* CHEMSPIDER:
+
{{#set: consumed by=THIOREDOXIN-REDUCT-NADPH-RXN}}
** [http://www.chemspider.com/Chemical-Structure.391650.html 391650]
+
{{#set: produced by=RXN0-5468|CDPREDUCT-RXN|RIBONUCLEOSIDE-DIP-REDUCTI-RXN|UDPREDUCT-RXN|RXN-8668|1.8.4.14-RXN|THIOREDOXIN-RXN|GDPREDUCT-RXN}}
* CHEBI:
+
{{#set: reversible reaction associated=ADPREDUCT-RXN|1.8.4.12-RXN|1.17.4.2-RXN|1.8.4.8-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38259 38259]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11832 C11832]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=3,8-divinyl chlorophyllide a}}
+
{{#set: molecular weight=610.951    }}
+
{{#set: produced by=RXN-5285}}
+

Latest revision as of 19:42, 21 March 2018

Metabolite Ox-Thioredoxin

  • common name:
    • an oxidized thioredoxin
  • Synonym(s):
    • thioredoxin disulfide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links