Difference between revisions of "ACP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACP ACP] == * common name: ** a holo-[acyl-carrier protein] * Synonym(s): ** a holo-ACP ** a ho...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACP ACP] ==
−
* smiles:
+
−
** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
+
−
* inchi key:
+
−
** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 6-sulfatoxymelatonin
+
** a holo-[acyl-carrier protein]
−
* molecular weight:
+
−
** 327.331   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 6-sulphatoxymelatonin
+
** a holo-ACP
−
** 6-hydroxymelatoninsulfate
+
** a holo-[acp]
−
** 6-hydroxymelatonin sulfate ester
+
−
** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.4.14-RXN]]
 +
* [[RXN-17155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-11058]]
+
* [[RXN-11474]]
 +
* [[RXN-17013]]
 +
* [[RXN-17012]]
 +
* [[RXN-17015]]
 +
* [[RXN-16615]]
 +
* [[RXN-17017]]
 +
* [[RXN-17016]]
 +
* [[RXN-17018]]
 +
* [[RXN-16067]]
 +
* [[RXN-16025]]
 +
* [[RXN-16024]]
 +
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 +
* [[RXN-17014]]
 +
* [[RXN-14972]]
 +
* [[RXN3O-1803]]
 +
* [[RXN-11484]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[2.3.1.179-RXN]]
 +
* [[RXN-9523]]
 +
* [[RXN0-6705]]
 +
* [[RXN-10654]]
 +
* [[RXN-10462]]
 +
* [[RXN-17020]]
 +
* [[RXN-10658]]
 +
* [[RXN0-5514]]
 +
* [[RXN-17024]]
 +
* [[RXN-9549]]
 +
* [[RXN-9548]]
 +
* [[RXN-16629]]
 +
* [[RXN-9527]]
 +
* [[RXN-16621]]
 +
* [[RXN-11479]]
 +
* [[RXN-16076]]
 +
* [[RXN-16077]]
 +
* [[RXN-16625]]
 +
* [[HOLO-ACP-SYNTH-RXN]]
 +
* [[RXN0-2141]]
 +
* [[RXN-17022]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[RXN-10727]]
 +
* [[RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58.]]
 +
* [[RXN-9555]]
 +
* [[RXN-9550]]
 +
* [[RXN-9539]]
 +
* [[RXN-9535]]
 +
* [[RXN-9516]]
 +
* [[RXN-9531]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.3.1.41-RXN]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a holo-[acyl-carrier protein]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65096 65096]
+
{{#set: common name=a holo-ACP|a holo-[acp]}}
−
* CHEMSPIDER:
+
{{#set: consumed by=3.1.4.14-RXN|RXN-17155}}
−
** [http://www.chemspider.com/Chemical-Structure.58606.html 58606]
+
{{#set: produced by=RXN-11474|RXN-17013|RXN-17012|RXN-17015|RXN-16615|RXN-17017|RXN-17016|RXN-17018|RXN-16067|RXN-16025|RXN-16024|1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN|RXN-17014|RXN-14972|RXN3O-1803|RXN-11484|3-OXOACYL-ACP-SYNTH-BASE-RXN|2.3.1.179-RXN|RXN-9523|RXN0-6705|RXN-10654|RXN-10462|RXN-17020|RXN-10658|RXN0-5514|RXN-17024|RXN-9549|RXN-9548|RXN-16629|RXN-9527|RXN-16621|RXN-11479|RXN-16076|RXN-16077|RXN-16625|HOLO-ACP-SYNTH-RXN|RXN0-2141|RXN-17022|3-OXOACYL-ACP-SYNTH-RXN|RXN-10727|RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58.|RXN-9555|RXN-9550|RXN-9539|RXN-9535|RXN-9516|RXN-9531}}
−
* HMDB : HMDB41815
+
{{#set: reversible reaction associated=2.3.1.41-RXN|RXN-8349_PLANTCYC|ACP-S-ACETYLTRANSFER-RXN|MALONYL-COA-ACP-TRANSACYL-RXN}}
−
{{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}}
+
−
{{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}}
+
−
{{#set: common name=6-sulfatoxymelatonin}}
+
−
{{#set: molecular weight=327.331    }}
+
−
{{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}}
+
−
{{#set: produced by=RXN-11058}}
+

Latest revision as of 19:42, 21 March 2018

Metabolite ACP

  • common name:
    • a holo-[acyl-carrier protein]
  • Synonym(s):
    • a holo-ACP
    • a holo-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a holo-[acyl-carrier protein" cannot be used as a page name in this wiki.
"a holo-[acp" cannot be used as a page name in this wiki.
"RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58." cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ACP&oldid=28837"