Difference between revisions of "COUMARATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_006230 == * left end position: ** 6343035 * transcription direction: ** NEGATIVE * right end position: ** 6349529 * centisome position: ** 97.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == * smiles: ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) * inchi key: ** InChIKey=NG...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NGSWKAQJJWESNS-ZZXKWVIFSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 4-coumarate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 163.152 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4-hydroxycinnamate |
| − | ** | + | ** 4-hydroxycinnamic acid |
| + | ** p-coumarate | ||
| + | ** trans-4-hydroxycinnamate | ||
| + | ** p-coumaric acid | ||
| + | ** trans-p-hydroxycinnamate | ||
| + | ** trans-4-coumarate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 7400-08-0 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54708745 54708745] |
| − | {{#set: | + | * HMDB : HMDB02035 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00811 C00811] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4450678.html 4450678] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12876 12876] | ||
| + | * METABOLIGHTS : MTBLC12876 | ||
| + | {{#set: smiles=C(=O)([O-])C=CC1(=CC=C(O)C=C1)}} | ||
| + | {{#set: inchi key=InChIKey=NGSWKAQJJWESNS-ZZXKWVIFSA-M}} | ||
| + | {{#set: common name=4-coumarate}} | ||
| + | {{#set: molecular weight=163.152 }} | ||
| + | {{#set: common name=4-hydroxycinnamate|4-hydroxycinnamic acid|p-coumarate|trans-4-hydroxycinnamate|p-coumaric acid|trans-p-hydroxycinnamate|trans-4-coumarate}} | ||
| + | {{#set: consumed by=4-COUMARATE--COA-LIGASE-RXN}} | ||
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite COUMARATE
- smiles:
- C(=O)([O-])C=CC1(=CC=C(O)C=C1)
- inchi key:
- InChIKey=NGSWKAQJJWESNS-ZZXKWVIFSA-M
- common name:
- 4-coumarate
- molecular weight:
- 163.152
- Synonym(s):
- 4-hydroxycinnamate
- 4-hydroxycinnamic acid
- p-coumarate
- trans-4-hydroxycinnamate
- p-coumaric acid
- trans-p-hydroxycinnamate
- trans-4-coumarate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7400-08-0
- PUBCHEM:
- HMDB : HMDB02035
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC12876
"C(=O)([O-])C=CC1(=CC=C(O)C=C1)" cannot be used as a page name in this wiki.
