Difference between revisions of "Ec-12 001440"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Ec-12_001440 == * left end position: ** 1427876 * transcription direction: ** NEGATIVE * right end position: ** 1432137 * centisome position: ** 17.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] ==
+
== Gene Ec-12_001440 ==
−
* smiles:
+
* left end position:
−
** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
+
** 1427876
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** cyclic- 3,4-O-oxalyl-L-threonate
+
** 1432137
−
* molecular weight:
+
* centisome position:
−
** 189.101    
+
** 17.128923    
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-cyclic oxalyl theronolactone
+
** Esi_0087_0032
 +
** Esi0087_0032
 +
** CYSRS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CYSTEINE--TRNA-LIGASE-RXN]]
−
* [[RXN-12872]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN1G-121]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY1G-0]]
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1427876}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658084 90658084]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)}}
+
{{#set: right end position=1432137}}
−
{{#set: inchi key=InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M}}
+
{{#set: centisome position=17.128923   }}
−
{{#set: common name=cyclic- 3,4-O-oxalyl-L-threonate}}
+
{{#set: common name=Esi_0087_0032|Esi0087_0032|CYSRS}}
−
{{#set: molecular weight=189.101   }}
+
{{#set: reaction associated=CYSTEINE--TRNA-LIGASE-RXN|RXN1G-121}}
−
{{#set: common name=3,4-cyclic oxalyl theronolactone}}
+
{{#set: pathway associated=PWY1G-0|TRNA-CHARGING-PWY}}
−
{{#set: produced by=RXN-12872}}
+

Latest revision as of 19:42, 21 March 2018

Gene Ec-12_001440

  • left end position:
    • 1427876
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1432137
  • centisome position:
    • 17.128923
  • Synonym(s):
    • Esi_0087_0032
    • Esi0087_0032
    • CYSRS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_001440&oldid=28872"