Difference between revisions of "RXN-12730"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12730 RXN-12730] == * direction: ** LEFT-TO-RIGHT * common name: ** 5-methyltetrahydropteroyltr...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12730 RXN-12730] ==
* smiles:
+
* direction:
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
+
 
* common name:
 
* common name:
** 2-trans-6-trans-tridecadienoyl-CoA
+
** 5-methyltetrahydropteroyltriglutamate--homocysteine S-methyltransferase
* molecular weight:
+
* ec number:
** 955.803   
+
** [http://enzyme.expasy.org/EC/2.1.1.14 EC-2.1.1.14]
 
* Synonym(s):
 
* Synonym(s):
** 2E, 6E-tridecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14785]]
+
** 1 [[SELENOHOMOCYSTEINE]][c] '''+''' 1 [[CPD-1302]][c] '''=>''' 1 [[SELENOMETHIONINE]][c] '''+''' 1 [[CPD-1301]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 seleno-L-homocysteine[c] '''+''' 1 N5-methyl--tetrahydropteroyl tri-L-glutamate[c] '''=>''' 1 seleno-L-methionine[c] '''+''' 1 tetrahydropteroyl tri-L-glutamate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-28_003190]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6936]], seleno-amino acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658431 90658431]
+
** [http://www.genome.jp/dbget-bin/www_bget?R09365 R09365]
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J}}
+
{{#set: common name=5-methyltetrahydropteroyltriglutamate--homocysteine S-methyltransferase}}
{{#set: common name=2-trans-6-trans-tridecadienoyl-CoA}}
+
{{#set: ec number=EC-2.1.1.14}}
{{#set: molecular weight=955.803    }}
+
{{#set: gene associated=Ec-28_003190}}
{{#set: common name=2E, 6E-tridecadienoyl-CoA}}
+
{{#set: in pathway=PWY-6936}}
{{#set: produced by=RXN-14785}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:43, 21 March 2018

Reaction RXN-12730

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 5-methyltetrahydropteroyltriglutamate--homocysteine S-methyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 seleno-L-homocysteine[c] + 1 N5-methyl--tetrahydropteroyl tri-L-glutamate[c] => 1 seleno-L-methionine[c] + 1 tetrahydropteroyl tri-L-glutamate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6936, seleno-amino acid biosynthesis: PWY-6936
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links