Difference between revisions of "1.3.1.9-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETOGLUTARATE 2-KETOGLUTARATE] == * smiles: ** C(CC([O-])=O)C(=O)C([O-])=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.1.9-RXN 1.3.1.9-RXN] == * direction: ** REVERSIBLE * common name: ** Glucose/ribitol dehydrogen...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.1.9-RXN 1.3.1.9-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Glucose/ribitol dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[NAD]][c] '''+''' 1 [[ACYL-ACP]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[TRANS-D2-ENOYL-ACP]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 NAD+[c] '''+''' 1 an acyl-[acyl-carrier protein][c] '''<=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 a trans-2-enoyl-[acyl-carrier protein][c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Ec-27_002470]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: EC-NUMBER | |
− | + | == Pathways == | |
− | + | == Reconstruction information == | |
− | + | * Category: [[annotation]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Tool: [[pathwaytools]] | |
− | + | ||
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01403 R01403] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=Glucose/ribitol dehydrogenase}} | |
− | + | {{#set: ec number=EC-1.3.1.9}} | |
− | + | {{#set: gene associated=Ec-27_002470}} | |
− | * LIGAND- | + | {{#set: in pathway=}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=annotation}} |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:43, 21 March 2018
Contents
Reaction 1.3.1.9-RXN
- direction:
- REVERSIBLE
- common name:
- Glucose/ribitol dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 ACYL-ACP[c] <=> 1 PROTON[c] + 1 NADH[c] + 1 TRANS-D2-ENOYL-ACP[c]
- With common name(s):
- 1 NAD+[c] + 1 an acyl-[acyl-carrier protein][c] <=> 1 H+[c] + 1 NADH[c] + 1 a trans-2-enoyl-[acyl-carrier protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_002470
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN: