Difference between revisions of "Ec-05 004740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-05_004740 == * left end position: ** 6701560 * transcription direction: ** POSITIVE * right end position: ** 6709870 * centisome position: ** 73.6...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_004740 == |
− | * | + | * left end position: |
− | ** | + | ** 6701560 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 6709870 |
− | * | + | * centisome position: |
− | ** | + | ** 73.61517 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0323_0043 |
+ | ** Esi0323_0043 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ACID-PHOSPHATASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[RXN-5822]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6348]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[NADPHOS-DEPHOS-PWY]] | ||
+ | * [[NAD-BIOSYNTHESIS-II]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6701560}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=6709870}} | |
− | + | {{#set: centisome position=73.61517 }} | |
− | + | {{#set: common name=Esi_0323_0043|Esi0323_0043}} | |
− | + | {{#set: reaction associated=ACID-PHOSPHATASE-RXN|RXN-5822}} | |
− | + | {{#set: pathway associated=PWY-6348|PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:43, 21 March 2018
Gene Ec-05_004740
- left end position:
- 6701560
- transcription direction:
- POSITIVE
- right end position:
- 6709870
- centisome position:
- 73.61517
- Synonym(s):
- Esi_0323_0043
- Esi0323_0043
Reactions associated
- Reaction: ACID-PHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-5822
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome