Difference between revisions of "2-ALPHA-HYDROXYETHYL-THPP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Galactosides Beta-D-Galactosides] == * common name: ** a β-D-galactoside * Synonym(...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Galactosides Beta-D-Galactosides] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
 +
* smiles:
 +
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
 +
* inchi key:
 +
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
 
* common name:
 
* common name:
** a β-D-galactoside
+
** 2-(α-hydroxyethyl)thiamine diphosphate
 +
* molecular weight:
 +
** 466.341   
 
* Synonym(s):
 
* Synonym(s):
** a β-D-galactoside
+
** 2-(α-hydroxyethyl)-TPP
** β-D-galactoside
+
** 2-(α-hydroxyethyl)-ThPP
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.23-RXN]]
+
* [[RXN-12508]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12583]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a β-D-galactoside}}
+
* PUBCHEM:
{{#set: common name=a β-D-galactoside|β-D-galactoside}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
{{#set: consumed by=3.2.1.23-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
 +
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
 +
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
 +
{{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}}
 +
{{#set: molecular weight=466.341    }}
 +
{{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}}
 +
{{#set: consumed by=RXN-12508}}
 +
{{#set: produced by=RXN-12583}}

Latest revision as of 19:43, 21 March 2018

Metabolite 2-ALPHA-HYDROXYETHYL-THPP

  • smiles:
    • CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
  • inchi key:
    • InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
  • common name:
    • 2-(α-hydroxyethyl)thiamine diphosphate
  • molecular weight:
    • 466.341
  • Synonym(s):
    • 2-(α-hydroxyethyl)-TPP
    • 2-(α-hydroxyethyl)-ThPP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.