Difference between revisions of "D-HEXOSE-6-PHOSPHATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.19.12-RXN 3.4.19.12-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** EF-hand domain pair...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) |
+ | * inchi key: | ||
+ | ** InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** D-hexose 6-phosphate |
− | + | * molecular weight: | |
− | * | + | ** 258.121 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[HEXOKINASE-RXN]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4459709 4459709] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.3658466.html 3658466] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61567 61567] |
− | {{#set: | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02965 C02965] | |
− | + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | |
− | + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L}} | |
− | + | {{#set: common name=D-hexose 6-phosphate}} | |
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: reversible reaction associated=HEXOKINASE-RXN}} |
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite D-HEXOSE-6-PHOSPHATE
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L
- common name:
- D-hexose 6-phosphate
- molecular weight:
- 258.121
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.