Difference between revisions of "CPD-514"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16378 RXN-16378] == * direction: ** REVERSIBLE * common name: ** Fatty acid hydroxylase * ec nu...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-514 CPD-514] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16378 RXN-16378] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-514 CPD-514] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=NHDPIYICCBKNNJ-FUEUKBNZSA-J
 
* common name:
 
* common name:
** Fatty acid hydroxylase
+
** 3-oxo-3-phenylpropanoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
+
** 909.648   
 
* Synonym(s):
 
* Synonym(s):
 +
** benzoyl-acetyl-CoA
 +
** oxocinnamoyl-CoA
 +
** 3-keto-3-phenylpropionyl-CoA
 +
** β-oxophenyl-propionyl-CoA
 +
** 3-oxo-3-phenylpropionyl-coenzyme A
 +
** 3-oxo-3-phenylpropionyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-2006]]
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[Delta7-Steroids]][c] '''<=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[Delta5-Delta7-Steroids]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 oxygen[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 2 H+[c] '''+''' 1 a &Delta;7-sterol[c] '''<=>''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] '''+''' 1 a &Delta;5,7-sterol[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-01_003780]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
{{#set: common name=Fatty acid hydroxylase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C07118 C07118]
{{#set: ec number=EC-1.14.19.20}}
+
* CHEBI:
{{#set: gene associated=Ec-01_003780}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27388 27388]
{{#set: in pathway=}}
+
* METABOLIGHTS : MTBLC27388
{{#set: reconstruction category=annotation}}
+
* PUBCHEM:
{{#set: reconstruction tool=pathwaytools}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203310 25203310]
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=NHDPIYICCBKNNJ-FUEUKBNZSA-J}}
 +
{{#set: common name=3-oxo-3-phenylpropanoyl-CoA}}
 +
{{#set: molecular weight=909.648    }}
 +
{{#set: common name=benzoyl-acetyl-CoA|oxocinnamoyl-CoA|3-keto-3-phenylpropionyl-CoA|&beta;-oxophenyl-propionyl-CoA|3-oxo-3-phenylpropionyl-coenzyme A|3-oxo-3-phenylpropionyl-CoA}}
 +
{{#set: consumed by=RXN-2006}}

Latest revision as of 20:43, 21 March 2018

Metabolite CPD-514

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
  • inchi key:
    • InChIKey=NHDPIYICCBKNNJ-FUEUKBNZSA-J
  • common name:
    • 3-oxo-3-phenylpropanoyl-CoA
  • molecular weight:
    • 909.648
  • Synonym(s):
    • benzoyl-acetyl-CoA
    • oxocinnamoyl-CoA
    • 3-keto-3-phenylpropionyl-CoA
    • β-oxophenyl-propionyl-CoA
    • 3-oxo-3-phenylpropionyl-coenzyme A
    • 3-oxo-3-phenylpropionyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.