Difference between revisions of "Ec-14 005080"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...")
 
(Created page with "Category:Gene == Gene Ec-14_005080 == * left end position: ** 4711320 * transcription direction: ** POSITIVE * right end position: ** 4718623 * centisome position: ** 71.8...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
+
== Gene Ec-14_005080 ==
−
* smiles:
+
* left end position:
−
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
+
** 4711320
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-(α-hydroxyethyl)thiamine diphosphate
+
** 4718623
−
* molecular weight:
+
* centisome position:
−
** 466.341    
+
** 71.81422    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-(α-hydroxyethyl)-TPP
+
** Esi_0399_0017
−
** 2-(α-hydroxyethyl)-ThPP
+
** Esi0399_0017
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12508]]
+
* Reaction: [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-12583]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4711320}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4718623}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
+
{{#set: centisome position=71.81422   }}
−
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
+
{{#set: common name=Esi_0399_0017|Esi0399_0017}}
−
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
+
{{#set: reaction associated=RXN-15556}}
−
{{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: molecular weight=466.341   }}
+
−
{{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}}
+
−
{{#set: consumed by=RXN-12508}}
+
−
{{#set: produced by=RXN-12583}}
+

Latest revision as of 19:43, 21 March 2018

Gene Ec-14_005080

  • left end position:
    • 4711320
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4718623
  • centisome position:
    • 71.81422
  • Synonym(s):
    • Esi_0399_0017
    • Esi0399_0017

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_005080&oldid=28931"