Difference between revisions of "GDP-TP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11347 RXN-11347] == * direction: ** LEFT-TO-RIGHT * common name: ** phospho-N-acetylmuramoyl-pe...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11347 RXN-11347] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
 +
* inchi key:
 +
** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
 
* common name:
 
* common name:
** phospho-N-acetylmuramoyl-pentapeptide-transferase
+
** pppGpp
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.7.8.13 EC-2.7.8.13]
+
** 677.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** guanosine pentaphosphate
 +
** guanosine 3'-diphosphate 5'-triphosphate
 +
** guanosine 5'-triphosphate,3'-diphosphate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-9646]][c] '''+''' 1 [[CPD-12258]][c] '''=>''' 1 [[CPD-12303]][c] '''+''' 1 [[UMP]][c]
+
* [[GTPPYPHOSKIN-RXN]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 di-trans,octa-cis-undecaprenyl phosphate[c] '''+''' 1 UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine[c] '''=>''' 1 undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine[c] '''+''' 1 UMP[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-07_007020]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
* [[PWY-6470]], peptidoglycan biosynthesis V (β-lactam resistance): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6470 PWY-6470]
+
** '''2''' reactions found over '''11''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
{{#set: common name=phospho-N-acetylmuramoyl-pentapeptide-transferase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494]
{{#set: ec number=EC-2.7.8.13}}
+
* CHEBI:
{{#set: gene associated=Ec-07_007020}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690]
{{#set: in pathway=PWY-6470}}
+
* BIGG : 43927
{{#set: reconstruction category=annotation}}
+
* PUBCHEM:
{{#set: reconstruction tool=pathwaytools}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549]
{{#set: reconstruction source=esiliculosus_genome}}
+
* HMDB : HMDB60480
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
 +
{{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}}
 +
{{#set: common name=pppGpp}}
 +
{{#set: molecular weight=677.095    }}
 +
{{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}}
 +
{{#set: produced by=GTPPYPHOSKIN-RXN}}

Latest revision as of 19:43, 21 March 2018

Metabolite GDP-TP

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
  • common name:
    • pppGpp
  • molecular weight:
    • 677.095
  • Synonym(s):
    • guanosine pentaphosphate
    • guanosine 3'-diphosphate 5'-triphosphate
    • guanosine 5'-triphosphate,3'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.