Difference between revisions of "Ec-22 000060"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
 
(Created page with "Category:Gene == Gene Ec-22_000060 == * left end position: ** 64371 * transcription direction: ** NEGATIVE * right end position: ** 71678 * centisome position: ** 1.425445...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
+
== Gene Ec-22_000060 ==
−
* smiles:
+
* left end position:
−
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
+
** 64371
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** L-threonylcarbamoyladenylate
+
** 71678
−
* molecular weight:
+
* centisome position:
−
** 490.322    
+
** 1.4254457    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0437_0012
 +
** Esi0437_0012
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14570]]
+
* Reaction: [[1.3.7.3-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[RXN-14569]]
+
* Reaction: [[1.3.7.4-RXN]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-7170]]
 +
* [[PWY-5915]]
 +
* [[PWY-7579]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=64371}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=71678}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
+
{{#set: centisome position=1.4254457    }}
−
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
+
{{#set: common name=Esi_0437_0012|Esi0437_0012}}
−
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
+
{{#set: reaction associated=1.3.7.3-RXN|1.3.7.4-RXN}}
−
{{#set: common name=L-threonylcarbamoyladenylate}}
+
{{#set: pathway associated=PWY-7170|PWY-5915|PWY-7579}}
−
{{#set: molecular weight=490.322    }}
+
−
{{#set: consumed by=RXN-14570}}
+
−
{{#set: consumed or produced by=RXN-14569}}
+

Latest revision as of 19:43, 21 March 2018

Gene Ec-22_000060

  • left end position:
    • 64371
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 71678
  • centisome position:
    • 1.4254457
  • Synonym(s):
    • Esi_0437_0012
    • Esi0437_0012

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000060&oldid=28962"