Difference between revisions of "1.8.1.4-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.1.4-RXN 1.8.1.4-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrolipoamide dehydr...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.1.4-RXN 1.8.1.4-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** dihydrolipoamide dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.8.1.4 EC-1.8.1.4] |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** E3 component of α-ketoacid dehydrogenase complexes |
− | ** | + | ** Diaphorase |
− | + | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[NAD]][c] '''+''' 1 [[Dihydro-Lipoyl-Proteins]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[Lipoyl-Protein-N6-lipoyllysine]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 NAD+[c] '''+''' 1 a [lipoyl-carrier protein] N6-dihydrolipoyl-L-lysine[c] '''=>''' 1 NADH[c] '''+''' 1 a [lipoyl-carrier protein]-N6-lipoyl-L-lysine[c] '''+''' 1 H+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-25_000020]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-27_004160]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33059 33059] |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15045 15045] |
− | * LIGAND- | + | * LIGAND-RXN: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08550 R08550] |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07618 R07618] |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03815 R03815] |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01698 R01698] |
− | ** [http://www. | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P52992 P52992] |
− | + | ** [http://www.uniprot.org/uniprot/O00087 O00087] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O17953 O17953] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/O50311 O50311] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q41219 Q41219] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/O81413 O81413] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P75393 P75393] |
+ | ** [http://www.uniprot.org/uniprot/Q9I1M1 Q9I1M1] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M0Q1 Q7M0Q1] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JZ09 Q9JZ09] | ||
+ | ** [http://www.uniprot.org/uniprot/Q04933 Q04933] | ||
+ | ** [http://www.uniprot.org/uniprot/P31023 P31023] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A0E8 P0A0E8] | ||
+ | ** [http://www.uniprot.org/uniprot/P31046 P31046] | ||
+ | ** [http://www.uniprot.org/uniprot/P11959 P11959] | ||
+ | ** [http://www.uniprot.org/uniprot/Q48419 Q48419] | ||
+ | ** [http://www.uniprot.org/uniprot/P49819 P49819] | ||
+ | ** [http://www.uniprot.org/uniprot/P47513 P47513] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59299 Q59299] | ||
+ | ** [http://www.uniprot.org/uniprot/P43784 P43784] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JU06 Q9JU06] | ||
+ | ** [http://www.uniprot.org/uniprot/Q60154 Q60154] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RRG6 Q9RRG6] | ||
+ | ** [http://www.uniprot.org/uniprot/P21880 P21880] | ||
+ | ** [http://www.uniprot.org/uniprot/P09063 P09063] | ||
+ | ** [http://www.uniprot.org/uniprot/P09623 P09623] | ||
+ | ** [http://www.uniprot.org/uniprot/P09622 P09622] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A9P0 P0A9P0] | ||
+ | ** [http://www.uniprot.org/uniprot/P18925 P18925] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JZP5 Q9JZP5] | ||
+ | ** [http://www.uniprot.org/uniprot/Q58053 Q58053] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59099 Q59099] | ||
+ | ** [http://www.uniprot.org/uniprot/P35484 P35484] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M0Y3 Q7M0Y3] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JUT1 Q9JUT1] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZD83 Q9ZD83] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M0Y4 Q7M0Y4] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JUT5 Q9JUT5] | ||
+ | ** [http://www.uniprot.org/uniprot/Q04829 Q04829] | ||
+ | ** [http://www.uniprot.org/uniprot/P31052 P31052] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M0Y5 Q7M0Y5] | ||
+ | ** [http://www.uniprot.org/uniprot/P09624 P09624] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=dihydrolipoamide dehydrogenase}} | ||
+ | {{#set: ec number=EC-1.8.1.4}} | ||
+ | {{#set: common name=E3 component of α-ketoacid dehydrogenase complexes|Diaphorase}} | ||
+ | {{#set: gene associated=Ec-25_000020|Ec-27_004160}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:44, 21 March 2018
Contents
Reaction 1.8.1.4-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- dihydrolipoamide dehydrogenase
- ec number:
- Synonym(s):
- E3 component of α-ketoacid dehydrogenase complexes
- Diaphorase
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 Dihydro-Lipoyl-Proteins[c] => 1 NADH[c] + 1 Lipoyl-Protein-N6-lipoyllysine[c] + 1 PROTON[c]
- With common name(s):
- 1 NAD+[c] + 1 a [lipoyl-carrier protein] N6-dihydrolipoyl-L-lysine[c] => 1 NADH[c] + 1 a [lipoyl-carrier protein]-N6-lipoyl-L-lysine[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-25_000020
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_004160
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: