Difference between revisions of "CPD-4127"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] == * common name: ** a 5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
 +
* smiles:
 +
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
 
* common name:
 
* common name:
** a 5-methylaminomethyl-2-thiouridine in tRNA
+
** isofucosterol
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
** a 5-methylaminomethyl-2-thiouridylate in tRNA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5144]]
+
* [[RXN-4210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a 5-methylaminomethyl-2-thiouridine in tRNA}}
+
* PUBCHEM:
{{#set: common name=a 5-methylaminomethyl-2-thiouridylate in tRNA}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244964 25244964]
{{#set: produced by=RXN0-5144}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
 +
* HMDB : HMDB02374
 +
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
 +
{{#set: common name=isofucosterol}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: produced by=RXN-4210}}

Latest revision as of 19:44, 21 March 2018

Metabolite CPD-4127

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
  • common name:
    • isofucosterol
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.