Difference between revisions of "RXN-7908"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJRKMK-...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7908 RXN-7908] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-alpha-hydroxytetrahydrobiop...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7908 RXN-7908] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 4-alpha-hydroxytetrahydrobiopterin dehydratase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.96 EC-4.2.1.96] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[CPD-5881]][c] '''=>''' 1 [[BIOPTERIN]][c] '''+''' 1 [[WATER]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 4α-hydroxy-tetrahydrobiopterin[c] '''=>''' 1 7,8-dihydrobiopterin[c] '''+''' 1 H2O[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Ec-12_001420]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: GO-TERM | |
− | * | + | == Pathways == |
− | + | * [[PHENYLALANINE-DEG1-PWY]], L-phenylalanine degradation I (aerobic): [http://metacyc.org/META/NEW-IMAGE?object=PHENYLALANINE-DEG1-PWY PHENYLALANINE-DEG1-PWY] | |
− | + | ** '''1''' reactions found over '''3''' reactions in the full pathway | |
− | + | == Reconstruction information == | |
− | * | + | * Category: [[annotation]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Tool: [[pathwaytools]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11920 11920] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04734 R04734] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=4-alpha-hydroxytetrahydrobiopterin dehydratase}} | |
− | * LIGAND- | + | {{#set: ec number=EC-4.2.1.96}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-12_001420}} |
− | + | {{#set: in pathway=PHENYLALANINE-DEG1-PWY}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:03, 21 March 2018
Contents
Reaction RXN-7908
- direction:
- LEFT-TO-RIGHT
- common name:
- 4-alpha-hydroxytetrahydrobiopterin dehydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 4α-hydroxy-tetrahydrobiopterin[c] => 1 7,8-dihydrobiopterin[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_001420
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- PHENYLALANINE-DEG1-PWY, L-phenylalanine degradation I (aerobic): PHENYLALANINE-DEG1-PWY
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links