Difference between revisions of "RXN3DJ-25"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * smiles: ** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-25 RXN3DJ-25] == * direction: ** LEFT-TO-RIGHT * common name: ** Sphingosine-1-phosphate pho...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-25 RXN3DJ-25] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Sphingosine-1-phosphate phosphatase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[CPD3DJ-11366]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[SPHINGOSINE]][c] '''+''' 1 [[Pi]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 sphingosine 1-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 sphingosine[c] '''+''' 1 phosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-00_007030]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY3DJ-11470]], sphingosine and sphingosine-1-phosphate metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11470 PWY3DJ-11470] | ||
| + | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27518 27518] | |
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06521 R06521] | |
| − | ** [http:// | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: common name=Sphingosine-1-phosphate phosphatase}} | |
| − | * LIGAND- | + | {{#set: gene associated=Ec-00_007030}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY3DJ-11470}} |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:44, 21 March 2018
Contents
Reaction RXN3DJ-25
- direction:
- LEFT-TO-RIGHT
- common name:
- Sphingosine-1-phosphate phosphatase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD3DJ-11366[c] + 1 WATER[c] => 1 SPHINGOSINE[c] + 1 Pi[c]
- With common name(s):
- 1 sphingosine 1-phosphate[c] + 1 H2O[c] => 1 sphingosine[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_007030
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY3DJ-11470, sphingosine and sphingosine-1-phosphate metabolism: PWY3DJ-11470
- 4 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
