Difference between revisions of "IMIDAZOLE-ACETOL-P"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCHOMOSERLYASE-RXN O-SUCCHOMOSERLYASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [ht...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) * inc...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == |
− | * | + | * smiles: |
− | ** | + | ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YCFFMSOLUMRAMD-UHFFFAOYSA-L |
+ | * common name: | ||
+ | ** imidazole acetol-phosphate | ||
+ | * molecular weight: | ||
+ | ** 218.105 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** imidazole acetol-P | ||
+ | ** 3-(imidazol-4-yl)-2-oxopropyl phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[HISTAMINOTRANS-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[IMIDPHOSDEHYD-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 99979-59-6 |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244516 25244516] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB12236 |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01267 C01267] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57766 57766] | |
− | * | + | * BIGG : 37231 |
− | + | {{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])=O)}} | |
− | + | {{#set: inchi key=InChIKey=YCFFMSOLUMRAMD-UHFFFAOYSA-L}} | |
− | + | {{#set: common name=imidazole acetol-phosphate}} | |
− | + | {{#set: molecular weight=218.105 }} | |
− | + | {{#set: common name=imidazole acetol-P|3-(imidazol-4-yl)-2-oxopropyl phosphate}} | |
− | {{#set: | + | {{#set: consumed by=HISTAMINOTRANS-RXN}} |
− | {{#set: | + | {{#set: produced by=IMIDPHOSDEHYD-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:44, 21 March 2018
Contents
Metabolite IMIDAZOLE-ACETOL-P
- smiles:
- C1(NC=NC=1CC(COP([O-])(=O)[O-])=O)
- inchi key:
- InChIKey=YCFFMSOLUMRAMD-UHFFFAOYSA-L
- common name:
- imidazole acetol-phosphate
- molecular weight:
- 218.105
- Synonym(s):
- imidazole acetol-P
- 3-(imidazol-4-yl)-2-oxopropyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC(COP([O-])(=O)[O-])=O)" cannot be used as a page name in this wiki.