Difference between revisions of "CREATINE-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == * smiles: ** C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+] * inchi key: **...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DRBBFCLWYRJSJZ-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** creatine-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 209.098 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N-phosphocreatine |
| − | ** | + | ** neo-ton |
| + | ** phosphorylcreatine | ||
| + | ** phosphocreatine | ||
| + | ** P-creatine | ||
| + | ** creatine-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[CREATINE-KINASE-RXN]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 67-07-2 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048563 7048563] |
| − | * HMDB : | + | * HMDB : HMDB01511 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02305 C02305] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5408799.html 5408799] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58092 58092] |
| − | * | + | * METABOLIGHTS : MTBLC58092 |
| − | {{#set: smiles= | + | {{#set: smiles=C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=DRBBFCLWYRJSJZ-UHFFFAOYSA-L}} |
| − | {{#set: common name= | + | {{#set: common name=creatine-phosphate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=209.098 }} |
| − | {{#set: common name= | + | {{#set: common name=N-phosphocreatine|neo-ton|phosphorylcreatine|phosphocreatine|P-creatine|creatine-P}} |
| − | {{#set: | + | {{#set: reversible reaction associated=CREATINE-KINASE-RXN}} |
| − | + | ||
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite CREATINE-P
- smiles:
- C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+]
- inchi key:
- InChIKey=DRBBFCLWYRJSJZ-UHFFFAOYSA-L
- common name:
- creatine-phosphate
- molecular weight:
- 209.098
- Synonym(s):
- N-phosphocreatine
- neo-ton
- phosphorylcreatine
- phosphocreatine
- P-creatine
- creatine-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 67-07-2
- PUBCHEM:
- HMDB : HMDB01511
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58092
"C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+" cannot be used as a page name in this wiki.
