Difference between revisions of "L-ALPHA-AMINO-EPSILON-KETO-PIMELATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] == * smiles: ** C1(N=CC=NC=1C(=O)N) * inchi key: ** InChIKey=IPEHBUM...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] == * smiles: ** C([O-]...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M |
* common name: | * common name: | ||
− | ** | + | ** L-α-amino-ε-keto-pimelate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 188.16 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-2-Amino-6-oxopimelate |
− | ** | + | ** L-2-Amino-6-oxoheptanedioate |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-4821]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202391 25202391] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58556 58556] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03871 C03871] |
− | {{#set: common name= | + | {{#set: smiles=C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+]}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M}} |
− | {{#set: common name= | + | {{#set: common name=L-α-amino-ε-keto-pimelate}} |
− | {{#set: | + | {{#set: molecular weight=188.16 }} |
+ | {{#set: common name=L-2-Amino-6-oxopimelate|L-2-Amino-6-oxoheptanedioate}} | ||
+ | {{#set: reversible reaction associated=RXN-4821}} |
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE
- smiles:
- C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+]
- inchi key:
- InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M
- common name:
- L-α-amino-ε-keto-pimelate
- molecular weight:
- 188.16
- Synonym(s):
- L-2-Amino-6-oxopimelate
- L-2-Amino-6-oxoheptanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+" cannot be used as a page name in this wiki.