Difference between revisions of "CPD-16618"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C(=O)[O-])C(O)[CH]=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M |
* common name: | * common name: | ||
− | ** | + | ** L-malic semialdehyde |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 117.081 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (3R)-3-hydroxy-4-oxobutanoate |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-6002]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049] |
− | + | {{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=L-malic semialdehyde}} |
− | {{#set: common name= | + | {{#set: molecular weight=117.081 }} |
− | {{#set: molecular weight= | + | {{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-6002}} |
− | {{#set: consumed by= | + | |
− | + |
Latest revision as of 19:45, 21 March 2018
Contents
Metabolite CPD-16618
- smiles:
- C(C(=O)[O-])C(O)[CH]=O
- inchi key:
- InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
- common name:
- L-malic semialdehyde
- molecular weight:
- 117.081
- Synonym(s):
- (3R)-3-hydroxy-4-oxobutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.