Difference between revisions of "3-oxo-dodecanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-dodecanoyl-ACPs 3-oxo-dodecanoyl-ACPs] == * common name: ** a 3-oxo-dodecanoyl-[acp] * Sy...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-dodecanoyl-ACPs 3-oxo-dodecanoyl-ACPs] ==
* smiles:
+
** C(C(=O)[O-])C(O)[CH]=O
+
* inchi key:
+
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
+
 
* common name:
 
* common name:
** L-malic semialdehyde
+
** a 3-oxo-dodecanoyl-[acp]
* molecular weight:
+
** 117.081   
+
 
* Synonym(s):
 
* Synonym(s):
** (3R)-3-hydroxy-4-oxobutanoate
+
** a 3-keto-dodecanoyl-[acp]
 +
** a 3-keto-dodecanoyl-[acyl-carrier-protein]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6002]]
+
* [[RXN-9532]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9652]]
 +
* [[RXN-9531]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 3-oxo-dodecanoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
+
{{#set: common name=a 3-keto-dodecanoyl-[acp]|a 3-keto-dodecanoyl-[acyl-carrier-protein]}}
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
+
{{#set: consumed by=RXN-9532}}
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
+
{{#set: produced by=RXN-9652|RXN-9531}}
{{#set: common name=L-malic semialdehyde}}
+
{{#set: molecular weight=117.081    }}
+
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+
{{#set: consumed by=RXN-6002}}
+

Latest revision as of 19:46, 21 March 2018

Metabolite 3-oxo-dodecanoyl-ACPs

  • common name:
    • a 3-oxo-dodecanoyl-[acp]
  • Synonym(s):
    • a 3-keto-dodecanoyl-[acp]
    • a 3-keto-dodecanoyl-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-dodecanoyl-[acp" cannot be used as a page name in this wiki.
  • "a 3-keto-dodecanoyl-[acp" cannot be used as a page name in this wiki.
  • "a 3-keto-dodecanoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.