Difference between revisions of "Ec-04 003640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == * smiles: ** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O...")
 
(Created page with "Category:Gene == Gene Ec-04_003640 == * left end position: ** 3716910 * transcription direction: ** POSITIVE * right end position: ** 3727340 * centisome position: ** 57.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] ==
+
== Gene Ec-04_003640 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3716910
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** trans-Δ2, cis-Δ4-decadienoyl-CoA
+
** 3727340
−
* molecular weight:
+
* centisome position:
−
** 913.722    
+
** 57.07916    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0080_0028
 +
** Esi0080_0028
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[DIENOYLCOAREDUCT-RXN]]
+
* Reaction: [[RXN-1225]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-401]]
 +
* [[PWY-7666]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3716910}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658212 90658212]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=3727340}}
−
{{#set: inchi key=InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J}}
+
{{#set: centisome position=57.07916    }}
−
{{#set: common name=trans-Δ2, cis-Δ4-decadienoyl-CoA}}
+
{{#set: common name=Esi_0080_0028|Esi0080_0028}}
−
{{#set: molecular weight=913.722    }}
+
{{#set: reaction associated=RXN-1225}}
−
{{#set: consumed by=DIENOYLCOAREDUCT-RXN}}
+
{{#set: pathway associated=PWY-401|PWY-7666}}

Latest revision as of 19:46, 21 March 2018

Gene Ec-04_003640

  • left end position:
    • 3716910
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3727340
  • centisome position:
    • 57.07916
  • Synonym(s):
    • Esi_0080_0028
    • Esi0080_0028

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_003640&oldid=29154"