Difference between revisions of "CPD-18666"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-27_003090 == * Synonym(s): ** Esi_0000_0591 ** Esi0000_0591 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == * smiles: ** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CC...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == |
| + | * smiles: | ||
| + | ** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M | ||
| + | * common name: | ||
| + | ** epoxypheophorbide a | ||
| + | * molecular weight: | ||
| + | ** 606.677 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-17253]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-17252]] |
| − | + | == Reaction(s) of unknown directionality == | |
== External links == | == External links == | ||
| − | {{#set: common name= | + | {{#set: smiles=CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M}} |
| − | {{#set: | + | {{#set: common name=epoxypheophorbide a}} |
| + | {{#set: molecular weight=606.677 }} | ||
| + | {{#set: consumed by=RXN-17253}} | ||
| + | {{#set: produced by=RXN-17252}} | ||
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite CPD-18666
- smiles:
- CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))
- inchi key:
- InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M
- common name:
- epoxypheophorbide a
- molecular weight:
- 606.677
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))" cannot be used as a page name in this wiki.
