Difference between revisions of "RXN-13415"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13415 RXN-13415] == * direction: ** LEFT-TO-RIGHT * common name: ** Deoxyhypusine synthase * Sy...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13415 RXN-13415] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Deoxyhypusine synthase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1 [[Deoxyhypusine-Synthase-Lysine]][c] '''+''' 1 [[CPD-14378]][c] '''=>''' 1 [[N-4-aminobutylidene-enzyme-lysine]][c] '''+''' 1 [[CPD-313]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 a [deoxyhypusine synthase]-L-lysine[c] '''+''' 1 dehydrospermidine[c] '''=>''' 1 a [deoxyhypusine synthase]-N-(4-aminobutylidene)-lysine[c] '''+''' 1 propane-1,3-diamine[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-27_002000]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-5905]], hypusine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5905 PWY-5905] | ||
| + | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=Deoxyhypusine synthase}} | |
| − | + | {{#set: gene associated=Ec-27_002000}} | |
| − | + | {{#set: in pathway=PWY-5905}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:03, 21 March 2018
Contents
Reaction RXN-13415
- direction:
- LEFT-TO-RIGHT
- common name:
- Deoxyhypusine synthase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Deoxyhypusine-Synthase-Lysine[c] + 1 CPD-14378[c] => 1 N-4-aminobutylidene-enzyme-lysine[c] + 1 CPD-313[c]
- With common name(s):
- 1 a [deoxyhypusine synthase]-L-lysine[c] + 1 dehydrospermidine[c] => 1 a [deoxyhypusine synthase]-N-(4-aminobutylidene)-lysine[c] + 1 propane-1,3-diamine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_002000
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
