Difference between revisions of "CPD-11740"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SULFOCYS-RXN SULFOCYS-RXN] == * direction: ** REVERSIBLE * common name: ** Tryptophan synthase beta...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == |
− | * | + | * smiles: |
− | ** | + | ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** carboxyphosphinopyruvate |
− | * | + | * molecular weight: |
− | + | ** 193.029 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-10828]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10827]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707] |
− | + | {{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}} | |
− | + | {{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}} | |
− | {{#set: | + | {{#set: common name=carboxyphosphinopyruvate}} |
− | + | {{#set: molecular weight=193.029 }} | |
− | + | {{#set: consumed by=RXN-10828}} | |
− | + | {{#set: produced by=RXN-10827}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:46, 21 March 2018
Contents
Metabolite CPD-11740
- smiles:
- C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
- inchi key:
- InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
- common name:
- carboxyphosphinopyruvate
- molecular weight:
- 193.029
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.