Difference between revisions of "BCCP-dimers"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] == * smiles: ** CC(C)=CCCC(=CCCC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-dimers BCCP-dimers] == * common name: ** a biotinylated [BCCP dimer] * Synonym(s): ** a bi...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-dimers BCCP-dimers] ==
* smiles:
+
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C
+
* inchi key:
+
** InChIKey=LKMQQQABIGIHGL-LAAQXVIISA-M
+
 
* common name:
 
* common name:
** 3-hexaprenyl-4-hydroxybenzoate
+
** a biotinylated [BCCP dimer]
* molecular weight:
+
** 545.824   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a biotinylated [biotin-carboxy-carrier-protein dimer]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9003]]
+
* [[RXN-7101]]
 +
* [[RXN0-5055]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a biotinylated [BCCP dimer]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740358 54740358]
+
{{#set: common name=a biotinylated [biotin-carboxy-carrier-protein dimer]}}
* CHEBI:
+
{{#set: produced by=RXN-7101|RXN0-5055}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84492 84492]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C13425 C13425]
+
* HMDB : HMDB06816
+
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=LKMQQQABIGIHGL-LAAQXVIISA-M}}
+
{{#set: common name=3-hexaprenyl-4-hydroxybenzoate}}
+
{{#set: molecular weight=545.824    }}
+
{{#set: produced by=RXN-9003}}
+

Latest revision as of 19:46, 21 March 2018

Metabolite BCCP-dimers

  • common name:
    • a biotinylated [BCCP dimer]
  • Synonym(s):
    • a biotinylated [biotin-carboxy-carrier-protein dimer]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a biotinylated [BCCP dimer" cannot be used as a page name in this wiki.
"a biotinylated [biotin-carboxy-carrier-protein dimer" cannot be used as a page name in this wiki.