Difference between revisions of "GLUTAMATE-1-SEMIALDEHYDE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-600 RXN-600] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec numb...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-1-SEMIALDEHYDE GLUTAMATE-1-SEMIALDEHYDE] == * smiles: ** [CH](C(CCC([O-])=O)[N+])=O *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-1-SEMIALDEHYDE GLUTAMATE-1-SEMIALDEHYDE] == |
− | * | + | * smiles: |
− | ** | + | ** [CH](C(CCC([O-])=O)[N+])=O |
+ | * inchi key: | ||
+ | ** InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-4-amino-5-oxopentanoate |
− | * | + | * molecular weight: |
− | ** | + | ** 131.131 |
* Synonym(s): | * Synonym(s): | ||
+ | ** L-glutamate 1-semialdehyde | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[GSAAMINOTRANS-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GLUTRNAREDUCT-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244684 25244684] |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57501 57501] | |
− | {{#set: | + | * BIGG : 42432 |
− | {{#set: | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03741 C03741] | |
− | {{#set: | + | {{#set: smiles=[CH](C(CCC([O-])=O)[N+])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N}} |
− | {{#set: | + | {{#set: common name=(S)-4-amino-5-oxopentanoate}} |
− | {{#set: | + | {{#set: molecular weight=131.131 }} |
− | + | {{#set: common name=L-glutamate 1-semialdehyde}} | |
− | + | {{#set: consumed by=GSAAMINOTRANS-RXN}} | |
+ | {{#set: produced by=GLUTRNAREDUCT-RXN}} |
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite GLUTAMATE-1-SEMIALDEHYDE
- smiles:
- [CH](C(CCC([O-])=O)[N+])=O
- inchi key:
- InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N
- common name:
- (S)-4-amino-5-oxopentanoate
- molecular weight:
- 131.131
- Synonym(s):
- L-glutamate 1-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](C(CCC([O-])=O)[N+])=O" cannot be used as a page name in this wiki.