Difference between revisions of "Ec-27 001550"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8117 CPD-8117] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(=O)[O-] * inchi key: ** InChIKey=VZCCE...") |
(Created page with "Category:Gene == Gene Ec-27_001550 == * left end position: ** 1290930 * transcription direction: ** POSITIVE * right end position: ** 1317155 * centisome position: ** 20.0...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_001550 == |
− | * | + | * left end position: |
− | ** | + | ** 1290930 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1317155 |
− | * | + | * centisome position: |
− | ** | + | ** 20.014708 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0366_0019 |
− | ** | + | ** Esi0366_0019 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1290930}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1317155}} | |
− | + | {{#set: centisome position=20.014708 }} | |
− | + | {{#set: common name=Esi_0366_0019|Esi0366_0019}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:47, 21 March 2018
Gene Ec-27_001550
- left end position:
- 1290930
- transcription direction:
- POSITIVE
- right end position:
- 1317155
- centisome position:
- 20.014708
- Synonym(s):
- Esi_0366_0019
- Esi0366_0019
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome