Difference between revisions of "Ec-18 004480"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-1-SEMIALDEHYDE GLUTAMATE-1-SEMIALDEHYDE] == * smiles: ** [CH](C(CCC([O-])=O)[N+])=O *...") |
(Created page with "Category:Gene == Gene Ec-18_004480 == * left end position: ** 4556355 * transcription direction: ** POSITIVE * right end position: ** 4564260 * centisome position: ** 92.4...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_004480 == |
− | * | + | * left end position: |
− | ** | + | ** 4556355 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4564260 |
− | * | + | * centisome position: |
− | ** | + | ** 92.48558 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0066_0074 |
+ | ** Esi0066_0074 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=4556355}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4564260}} | |
− | + | {{#set: centisome position=92.48558 }} | |
− | + | {{#set: common name=Esi_0066_0074|Esi0066_0074}} | |
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:47, 21 March 2018
Gene Ec-18_004480
- left end position:
- 4556355
- transcription direction:
- POSITIVE
- right end position:
- 4564260
- centisome position:
- 92.48558
- Synonym(s):
- Esi_0066_0074
- Esi0066_0074
Reactions associated
- Reaction: NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome