Difference between revisions of "Ec-12 000150"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * smiles: ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-12_000150 == * Synonym(s): ** Esi_0069_0024 ** Esi0069_0024 == Reactions associated == * Reaction: ACETYLORNDEACET-RXN ** Source: orthology...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_000150 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0069_0024 |
− | ** | + | ** Esi0069_0024 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ACETYLORNDEACET-RXN]] |
− | == | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | == Pathways associated == |
− | + | * [[GLUTORN-PWY]] | |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0069_0024|Esi0069_0024}} | |
− | + | {{#set: reaction associated=ACETYLORNDEACET-RXN}} | |
− | + | {{#set: pathway associated=GLUTORN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:47, 21 March 2018
Gene Ec-12_000150
- Synonym(s):
- Esi_0069_0024
- Esi0069_0024
Reactions associated
- Reaction: ACETYLORNDEACET-RXN
- Source: orthology-aragem