Difference between revisions of "OLEOYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14014 RXN-14014] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrodipicolinate reducta...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** oleoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 1027.953 |
* Synonym(s): | * Synonym(s): | ||
+ | ** oloeyl-CoA (cis) | ||
+ | ** cis-octadec-9-enoyl-CoA | ||
+ | ** (9Z)-octadec-9-enoyl-CoA | ||
+ | ** 18:1 cis-9 | ||
+ | ** 18:1(n-9) | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-15044]] |
− | + | * [[RXN-15045]] | |
− | * | + | * [[RXN-15043]] |
− | + | * [[RXN-13322]] | |
− | + | * [[RXN-9601]] | |
− | + | * [[RXN-17775]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[RXN-9644]] |
− | + | * [[RXN0-7239]] | |
− | + | * [[1.14.19.1-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | * [[RXN-9670]] |
− | + | * [[RXN-15036]] | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00510 C00510] |
− | ** [http://www. | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57387 57387] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57387 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245426 25245426] |
− | {{#set: | + | * HMDB : HMDB01322 |
− | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J}} |
− | {{#set: | + | {{#set: common name=oleoyl-CoA}} |
+ | {{#set: molecular weight=1027.953 }} | ||
+ | {{#set: common name=oloeyl-CoA (cis)|cis-octadec-9-enoyl-CoA|(9Z)-octadec-9-enoyl-CoA|18:1 cis-9|18:1(n-9)}} | ||
+ | {{#set: consumed by=RXN-15044|RXN-15045|RXN-15043|RXN-13322|RXN-9601|RXN-17775}} | ||
+ | {{#set: produced by=RXN-9644|RXN0-7239|1.14.19.1-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-9670|RXN-15036}} |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite OLEOYL-COA
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J
- common name:
- oleoyl-CoA
- molecular weight:
- 1027.953
- Synonym(s):
- oloeyl-CoA (cis)
- cis-octadec-9-enoyl-CoA
- (9Z)-octadec-9-enoyl-CoA
- 18:1 cis-9
- 18:1(n-9)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.